ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate

C12H20O2 — CID 66808810

IUPACethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate
SMILESC=C1CCC(C(=O)OCC)C(C)(C)C1
InChIInChI=1S/C12H20O2/c1-5-14-11(13)10-7-6-9(2)8-12(10,3)4/h10H,2,5-8H2,1,3-4H3
InChIKeyGAWQDVIYKJUXCE-UHFFFAOYSA-N
MW196.29 g/mol
LogP2.93
Rot. Bonds2

About ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate

ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate (PubChem CID 66808810) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate.

Molecular Properties

Compound Nameethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate
PubChem CID66808810
Molecular FormulaC12H20O2
Molecular Weight196.29 g/mol
Exact Mass196.15
IUPAC Nameethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate
SMILESC=C1CCC(C(=O)OCC)C(C)(C)C1
InChIInChI=1S/C12H20O2/c1-5-14-11(13)10-7-6-9(2)8-12(10,3)4/h10H,2,5-8H2,1,3-4H3
InChIKeyGAWQDVIYKJUXCE-UHFFFAOYSA-N
XLogP2.93
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.29
LogP ≤ 52.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate?
The IUPAC name of ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate (CID 66808810) is ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate?
The canonical SMILES for ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate is C=C1CCC(C(=O)OCC)C(C)(C)C1.
What is the InChIKey of ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate?
The InChIKey is GAWQDVIYKJUXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-5-14-11(13)10-7-6-9(2)8-12(10,3)4/h10H,2,5-8H2,1,3-4H3.
What are the key properties of ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate?
ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate has a molecular weight of 196.29 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-dimethyl-4-methylidenecyclohexane-1-carboxylate is sourced from PubChem (CID 66808810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).