C12H19FO5 — CID 66808938
(1S,2R,5S)-2-[(1R)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-fluoro-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,5-diol (PubChem CID 66808938) has the molecular formula C12H19FO5 and a molecular weight of 262.28 g/mol. Its IUPAC name is (1S,2R,5S)-2-[(1R)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-fluoro-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,5-diol.
| Compound Name | (1S,2R,5S)-2-[(1R)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-fluoro-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,5-diol |
|---|---|
| PubChem CID | 66808938 |
| Molecular Formula | C12H19FO5 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1S,2R,5S)-2-[(1R)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-fluoro-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,5-diol |
| SMILES | CC1(C)C(O)[C@@]1(O)[C@H]1OC(F)[C@]2(O)C(C)(C)[C@]12O |
| InChI | InChI=1S/C12H19FO5/c1-8(2)5(14)10(8,15)6-11(16)9(3,4)12(11,17)7(13)18-6/h5-7,14-17H,1-4H3/t5?,6-,7?,10-,11-,12+/m1/s1 |
| InChIKey | FCAINJUDJMEOMH-JXHFIPLVSA-N |
| XLogP | -0.69 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |