About [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol
[2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol (PubChem CID 66809111) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol |
| PubChem CID | 66809111 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol |
| SMILES | OCC1C=CCOC1CO |
| InChI | InChI=1S/C7H12O3/c8-4-6-2-1-3-10-7(6)5-9/h1-2,6-9H,3-5H2 |
| InChIKey | LWXOYXNRKADMLP-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol?
The IUPAC name of [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol (CID 66809111) is [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol.
What is the SMILES notation for [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol?
The canonical SMILES for [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol is OCC1C=CCOC1CO.
What is the InChIKey of [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol?
The InChIKey is LWXOYXNRKADMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c8-4-6-2-1-3-10-7(6)5-9/h1-2,6-9H,3-5H2.
What are the key properties of [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol?
[2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol has a molecular weight of 144.17 g/mol, XLogP of -0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]methanol is sourced from PubChem (CID 66809111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).