About bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+)
bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) (PubChem CID 66809160) has the molecular formula C28H44CuN3
and a molecular weight of 486.23 g/mol. Its IUPAC name is bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+).
Molecular Properties
| Compound Name | bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) |
| PubChem CID | 66809160 |
| Molecular Formula | C28H44CuN3 |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) |
| SMILES | CC(C)c1cccc(C(C)C)c1C(N)C[N-]CC(N)c1c(C(C)C)cccc1C(C)C.[Cu+] |
| InChI | InChI=1S/C28H44N3.Cu/c1-17(2)21-11-9-12-22(18(3)4)27(21)25(29)15-31-16-26(30)28-23(19(5)6)13-10-14-24(28)20(7)8;/h9-14,17-20,25-26H,15-16,29-30H2,1-8H3;/q-1;+1 |
| InChIKey | DOUAAWFLKINOOQ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+)?
The IUPAC name of bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) (CID 66809160) is bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+).
What is the SMILES notation for bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+)?
The canonical SMILES for bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) is CC(C)c1cccc(C(C)C)c1C(N)C[N-]CC(N)c1c(C(C)C)cccc1C(C)C.[Cu+].
What is the InChIKey of bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+)?
The InChIKey is DOUAAWFLKINOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44N3.Cu/c1-17(2)21-11-9-12-22(18(3)4)27(21)25(29)15-31-16-26(30)28-23(19(5)6)13-10-14-24(28)20(7)8;/h9-14,17-20,25-26H,15-16,29-30H2,1-8H3;/q-1;+1.
What are the key properties of bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+)?
bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) has a molecular weight of 486.23 g/mol, XLogP of 7.25, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-amino-2-[2,6-di(propan-2-yl)phenyl]ethyl]azanide;copper(1+) is sourced from PubChem (CID 66809160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).