About benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate
benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 66809209) has the molecular formula C23H26N2O4
and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 66809209 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)OC1CC(CC2CNc3ccccc32)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C23H26N2O4/c1-16(26)29-20-12-19(11-18-13-24-22-10-6-5-9-21(18)22)25(14-20)23(27)28-15-17-7-3-2-4-8-17/h2-10,18-20,24H,11-15H2,1H3 |
| InChIKey | WTPQHHYDMGLQLG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate (CID 66809209) is benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate is CC(=O)OC1CC(CC2CNc3ccccc32)N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate?
The InChIKey is WTPQHHYDMGLQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O4/c1-16(26)29-20-12-19(11-18-13-24-22-10-6-5-9-21(18)22)25(14-20)23(27)28-15-17-7-3-2-4-8-17/h2-10,18-20,24H,11-15H2,1H3.
What are the key properties of benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate?
benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate has a molecular weight of 394.47 g/mol, XLogP of 3.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-acetyloxy-2-(2,3-dihydro-1H-indol-3-ylmethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 66809209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).