About 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile
2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 668096) has the molecular formula C20H13N3
and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile |
| PubChem CID | 668096 |
| Molecular Formula | C20H13N3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)c(C#N)c1N |
| InChI | InChI=1S/C20H13N3/c21-12-18-16(14-7-3-1-4-8-14)11-17(19(13-22)20(18)23)15-9-5-2-6-10-15/h1-11H,23H2 |
| InChIKey | FYLKFHCJXCBNQG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile?
The IUPAC name of 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile (CID 668096) is 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile is N#Cc1c(-c2ccccc2)cc(-c2ccccc2)c(C#N)c1N.
What is the InChIKey of 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile?
The InChIKey is FYLKFHCJXCBNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N3/c21-12-18-16(14-7-3-1-4-8-14)11-17(19(13-22)20(18)23)15-9-5-2-6-10-15/h1-11H,23H2.
What are the key properties of 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile?
2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile has a molecular weight of 295.35 g/mol, XLogP of 4.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-diphenylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 668096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).