C17H15N7 — CID 66809866
6-prop-2-enyl-3-[6-(6-prop-2-enyl-1,2,4-triazin-3-yl)-2-pyridinyl]-1,2,4-triazine (PubChem CID 66809866) has the molecular formula C17H15N7 and a molecular weight of 317.36 g/mol. Its IUPAC name is 6-prop-2-enyl-3-[6-(6-prop-2-enyl-1,2,4-triazin-3-yl)-2-pyridinyl]-1,2,4-triazine.
| Compound Name | 6-prop-2-enyl-3-[6-(6-prop-2-enyl-1,2,4-triazin-3-yl)-2-pyridinyl]-1,2,4-triazine |
|---|---|
| PubChem CID | 66809866 |
| Molecular Formula | C17H15N7 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-prop-2-enyl-3-[6-(6-prop-2-enyl-1,2,4-triazin-3-yl)-2-pyridinyl]-1,2,4-triazine |
| SMILES | C=CCc1cnc(-c2cccc(-c3ncc(CC=C)nn3)n2)nn1 |
| InChI | InChI=1S/C17H15N7/c1-3-6-12-10-18-16(23-21-12)14-8-5-9-15(20-14)17-19-11-13(7-4-2)22-24-17/h3-5,8-11H,1-2,6-7H2 |
| InChIKey | VFDLSOOPOHMEKN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|