C28H26N2O5 — CID 66810031
2-cyclohexyl-1,3-dioxo-7-(2-phenylethylcarbamoyl)benzo[de]isoquinoline-6-carboxylic acid (PubChem CID 66810031) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dioxo-7-(2-phenylethylcarbamoyl)benzo[de]isoquinoline-6-carboxylic acid.
| Compound Name | 2-cyclohexyl-1,3-dioxo-7-(2-phenylethylcarbamoyl)benzo[de]isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 66810031 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-cyclohexyl-1,3-dioxo-7-(2-phenylethylcarbamoyl)benzo[de]isoquinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c3c(ccc(C(=O)NCCc4ccccc4)c13)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C28H26N2O5/c31-25(29-16-15-17-7-3-1-4-8-17)19-11-12-20-24-21(13-14-22(23(19)24)28(34)35)27(33)30(26(20)32)18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15-16H2,(H,29,31)(H,34,35) |
| InChIKey | USUZFSPGPTZWPG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|