About 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane
1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane (PubChem CID 66810183) has the molecular formula C17H34N4
and a molecular weight of 294.49 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane |
| PubChem CID | 66810183 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane |
| SMILES | C1CN2CCN1CC2.CCCCCC1CN2CCN1CC2 |
| InChI | InChI=1S/C11H22N2.C6H12N2/c1-2-3-4-5-11-10-12-6-8-13(11)9-7-12;1-2-8-5-3-7(1)4-6-8/h11H,2-10H2,1H3;1-6H2 |
| InChIKey | OUNSISNMGAMKLH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane (CID 66810183) is 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane is C1CN2CCN1CC2.CCCCCC1CN2CCN1CC2.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane?
The InChIKey is OUNSISNMGAMKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.C6H12N2/c1-2-3-4-5-11-10-12-6-8-13(11)9-7-12;1-2-8-5-3-7(1)4-6-8/h11H,2-10H2,1H3;1-6H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane?
1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane has a molecular weight of 294.49 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;2-pentyl-1,4-diazabicyclo[2.2.2]octane is sourced from PubChem (CID 66810183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).