C11H22N2 — CID 66810184
2-pentyl-1,4-diazabicyclo[2.2.2]octane (PubChem CID 66810184) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-pentyl-1,4-diazabicyclo[2.2.2]octane.
| Compound Name | 2-pentyl-1,4-diazabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 66810184 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-pentyl-1,4-diazabicyclo[2.2.2]octane |
| SMILES | CCCCCC1CN2CCN1CC2 |
| InChI | InChI=1S/C11H22N2/c1-2-3-4-5-11-10-12-6-8-13(11)9-7-12/h11H,2-10H2,1H3 |
| InChIKey | BHCKOXBXLFQFHQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|