C17H21F2NO3 — CID 66810273
tert-butyl-[2-(2,5-difluorophenyl)-5-methylideneoxan-3-yl]carbamic acid (PubChem CID 66810273) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is tert-butyl-[2-(2,5-difluorophenyl)-5-methylideneoxan-3-yl]carbamic acid.
| Compound Name | tert-butyl-[2-(2,5-difluorophenyl)-5-methylideneoxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 66810273 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl-[2-(2,5-difluorophenyl)-5-methylideneoxan-3-yl]carbamic acid |
| SMILES | C=C1COC(c2cc(F)ccc2F)C(N(C(=O)O)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H21F2NO3/c1-10-7-14(20(16(21)22)17(2,3)4)15(23-9-10)12-8-11(18)5-6-13(12)19/h5-6,8,14-15H,1,7,9H2,2-4H3,(H,21,22) |
| InChIKey | CZOHBDQRTVQZIG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|