C19H11N3O4S — CID 66810403
5-sulfamoyl-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene-15-carboxylic acid (PubChem CID 66810403) has the molecular formula C19H11N3O4S and a molecular weight of 377.38 g/mol. Its IUPAC name is 5-sulfamoyl-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene-15-carboxylic acid.
| Compound Name | 5-sulfamoyl-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene-15-carboxylic acid |
|---|---|
| PubChem CID | 66810403 |
| Molecular Formula | C19H11N3O4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-sulfamoyl-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene-15-carboxylic acid |
| SMILES | NS(=O)(=O)c1cnc2ccc3c(c2n1)-c1cccc2c(C(=O)O)ccc-3c12 |
| InChI | InChI=1S/C19H11N3O4S/c20-27(25,26)15-8-21-14-7-6-11-10-4-5-12(19(23)24)9-2-1-3-13(16(9)10)17(11)18(14)22-15/h1-8H,(H,23,24)(H2,20,25,26) |
| InChIKey | DYUZKOUBAPQLGR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |