C18H19F3N4O5S — CID 66810547
[(2S,3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-yl]carbamic acid (PubChem CID 66810547) has the molecular formula C18H19F3N4O5S and a molecular weight of 460.43 g/mol. Its IUPAC name is [(2S,3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-yl]carbamic acid.
| Compound Name | [(2S,3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 66810547 |
| Molecular Formula | C18H19F3N4O5S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [(2S,3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-yl]carbamic acid |
| SMILES | CS(=O)(=O)n1cc2c(n1)CN([C@H]1CO[C@@H](c3cc(F)c(F)cc3F)[C@@H](NC(=O)O)C1)C2 |
| InChI | InChI=1S/C18H19F3N4O5S/c1-31(28,29)25-6-9-5-24(7-16(9)23-25)10-2-15(22-18(26)27)17(30-8-10)11-3-13(20)14(21)4-12(11)19/h3-4,6,10,15,17,22H,2,5,7-8H2,1H3,(H,26,27)/t10-,15+,17+/m1/s1 |
| InChIKey | XHSHLQKSHRITRF-PHEKWQANSA-N |
| XLogP | 1.59 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|