C12H10F3NO3 — CID 66810550
(2R,3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane (PubChem CID 66810550) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is (2R,3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane.
| Compound Name | (2R,3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane |
|---|---|
| PubChem CID | 66810550 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2R,3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane |
| SMILES | C=C1CO[C@H](c2cc(F)c(F)cc2F)[C@@H]([N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H10F3NO3/c1-6-2-11(16(17)18)12(19-5-6)7-3-9(14)10(15)4-8(7)13/h3-4,11-12H,1-2,5H2/t11-,12+/m0/s1 |
| InChIKey | KPSCJXZYOCIAHZ-NWDGAFQWSA-N |
| XLogP | 2.77 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|