C18H15N3 — CID 668106
2-amino-4-phenyl-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile (PubChem CID 668106) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-amino-4-phenyl-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-phenyl-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 668106 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-amino-4-phenyl-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C18H15N3/c19-10-15-13-8-4-5-9-14(13)17(16(11-20)18(15)21)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-9,21H2 |
| InChIKey | AYONILJEROJJFQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|