About 2-bromofluoren-1-one
2-bromofluoren-1-one (PubChem CID 66810654) has the molecular formula C13H7BrO
and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-bromofluoren-1-one.
Molecular Properties
| Compound Name | 2-bromofluoren-1-one |
| PubChem CID | 66810654 |
| Molecular Formula | C13H7BrO |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 2-bromofluoren-1-one |
| SMILES | O=C1C(Br)=CC=C2C1=Cc1ccccc12 |
| InChI | InChI=1S/C13H7BrO/c14-12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)15/h1-7H |
| InChIKey | QFUPJXCUNNWZJQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-bromofluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromofluoren-1-one?
The IUPAC name of 2-bromofluoren-1-one (CID 66810654) is 2-bromofluoren-1-one.
What is the SMILES notation for 2-bromofluoren-1-one?
The canonical SMILES for 2-bromofluoren-1-one is O=C1C(Br)=CC=C2C1=Cc1ccccc12.
What is the InChIKey of 2-bromofluoren-1-one?
The InChIKey is QFUPJXCUNNWZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrO/c14-12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)15/h1-7H.
What are the key properties of 2-bromofluoren-1-one?
2-bromofluoren-1-one has a molecular weight of 259.10 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromofluoren-1-one is sourced from PubChem (CID 66810654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).