C23H23ClFN3O3 — CID 66811657
2-[3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66811657) has the molecular formula C23H23ClFN3O3 and a molecular weight of 443.91 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66811657 |
| Molecular Formula | C23H23ClFN3O3 |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | CN(C(=O)NCc1ccccc1Cl)C1CCc2c(c3cc(F)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C23H23ClFN3O3/c1-27(23(31)26-12-14-4-2-3-5-19(14)24)16-7-9-21-18(11-16)17-10-15(25)6-8-20(17)28(21)13-22(29)30/h2-6,8,10,16H,7,9,11-13H2,1H3,(H,26,31)(H,29,30) |
| InChIKey | JWLFNLXYKJSOML-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|