C35H33FN2O4 — CID 66812358
2-[6-fluoro-3-[3-(2-methoxyphenyl)propanoyl-(naphthalen-1-ylmethyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 66812358) has the molecular formula C35H33FN2O4 and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-[6-fluoro-3-[3-(2-methoxyphenyl)propanoyl-(naphthalen-1-ylmethyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-[3-(2-methoxyphenyl)propanoyl-(naphthalen-1-ylmethyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 66812358 |
| Molecular Formula | C35H33FN2O4 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[6-fluoro-3-[3-(2-methoxyphenyl)propanoyl-(naphthalen-1-ylmethyl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | COc1ccccc1CCC(=O)N(Cc1cccc2ccccc12)C1CCc2c(c3cc(F)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C35H33FN2O4/c1-42-33-12-5-3-8-24(33)13-18-34(39)37(21-25-10-6-9-23-7-2-4-11-28(23)25)27-15-17-32-30(20-27)29-19-26(36)14-16-31(29)38(32)22-35(40)41/h2-12,14,16,19,27H,13,15,17-18,20-22H2,1H3,(H,40,41) |
| InChIKey | HIJAYGRULIVJNL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|