C21H24ClN7O3 — CID 66812565
8-chloro-3-(2-methylbutyl)-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-7H-purine-2,6-dione (PubChem CID 66812565) has the molecular formula C21H24ClN7O3 and a molecular weight of 457.92 g/mol. Its IUPAC name is 8-chloro-3-(2-methylbutyl)-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-7H-purine-2,6-dione.
| Compound Name | 8-chloro-3-(2-methylbutyl)-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 66812565 |
| Molecular Formula | C21H24ClN7O3 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 8-chloro-3-(2-methylbutyl)-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-7H-purine-2,6-dione |
| SMILES | CCC(C)Cn1c(=O)n(CCCCc2nc(-c3ccccn3)no2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C21H24ClN7O3/c1-3-13(2)12-29-18-16(25-20(22)26-18)19(30)28(21(29)31)11-7-5-9-15-24-17(27-32-15)14-8-4-6-10-23-14/h4,6,8,10,13H,3,5,7,9,11-12H2,1-2H3,(H,25,26) |
| InChIKey | DAGSGAJRLOSEPY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|