C25H25F2N3O — CID 66812773
(2S)-1-(3-fluorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-4-methylpentan-2-amine (PubChem CID 66812773) has the molecular formula C25H25F2N3O and a molecular weight of 421.49 g/mol. Its IUPAC name is (2S)-1-(3-fluorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-4-methylpentan-2-amine.
| Compound Name | (2S)-1-(3-fluorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 66812773 |
| Molecular Formula | C25H25F2N3O |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2S)-1-(3-fluorophenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-4-methylpentan-2-amine |
| SMILES | CC(C)C[C@H](N)C(Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C25H25F2N3O/c1-16(2)12-23(28)25(17-4-3-5-20(27)13-17)31-22-10-11-24-18(14-22)15-29-30(24)21-8-6-19(26)7-9-21/h3-11,13-16,23,25H,12,28H2,1-2H3/t23-,25?/m0/s1 |
| InChIKey | GFEABVLYRZUQNO-LFQPHHBNSA-N |
| XLogP | 5.80 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |