C38H38F2N2O9 — CID 66813197
benzyl (2S)-2-[[6-fluoro-2-(4-fluorophenyl)-1-[(2R,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 66813197) has the molecular formula C38H38F2N2O9 and a molecular weight of 704.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[6-fluoro-2-(4-fluorophenyl)-1-[(2R,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[6-fluoro-2-(4-fluorophenyl)-1-[(2R,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66813197 |
| Molecular Formula | C38H38F2N2O9 |
| Molecular Weight | 704.72 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | benzyl (2S)-2-[[6-fluoro-2-(4-fluorophenyl)-1-[(2R,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1c(-c2ccc(F)cc2)c(C[C@@H]2CCCN2C(=O)OCc2ccccc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C38H38F2N2O9/c1-22(43)49-33-21-47-37(36(51-24(3)45)35(33)50-23(2)44)42-32-18-28(40)15-16-30(32)31(34(42)26-11-13-27(39)14-12-26)19-29-10-7-17-41(29)38(46)48-20-25-8-5-4-6-9-25/h4-6,8-9,11-16,18,29,33,35-37H,7,10,17,19-21H2,1-3H3/t29-,33+,35-,36+,37+/m0/s1 |
| InChIKey | MBUHJZQYXCPFRP-TUWRDAKGSA-N |
| XLogP | 6.25 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|