C12H10BrF3N2O2 — CID 66813401
1-[(4-bromophenyl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione (PubChem CID 66813401) has the molecular formula C12H10BrF3N2O2 and a molecular weight of 351.12 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66813401 |
| Molecular Formula | C12H10BrF3N2O2 |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(Cc2ccc(Br)cc2)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C12H10BrF3N2O2/c13-9-3-1-8(2-4-9)5-17-6-10(19)18(11(17)20)7-12(14,15)16/h1-4H,5-7H2 |
| InChIKey | PNKKTMZERINZHP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|