C23H22N2O4 — CID 66813447
2,4-dimethoxy-N-[(3S)-5-pyridin-4-yl-3,4-dihydro-2H-chromen-3-yl]benzamide (PubChem CID 66813447) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(3S)-5-pyridin-4-yl-3,4-dihydro-2H-chromen-3-yl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[(3S)-5-pyridin-4-yl-3,4-dihydro-2H-chromen-3-yl]benzamide |
|---|---|
| PubChem CID | 66813447 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2,4-dimethoxy-N-[(3S)-5-pyridin-4-yl-3,4-dihydro-2H-chromen-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2COc3cccc(-c4ccncc4)c3C2)c(OC)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-27-17-6-7-19(22(13-17)28-2)23(26)25-16-12-20-18(15-8-10-24-11-9-15)4-3-5-21(20)29-14-16/h3-11,13,16H,12,14H2,1-2H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | HKYBBQGISPGEAA-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |