C20H12Cl2O4 — CID 66813638
4',5'-dichlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol (PubChem CID 66813638) has the molecular formula C20H12Cl2O4 and a molecular weight of 387.22 g/mol. Its IUPAC name is 4',5'-dichlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol.
| Compound Name | 4',5'-dichlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol |
|---|---|
| PubChem CID | 66813638 |
| Molecular Formula | C20H12Cl2O4 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 4',5'-dichlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol |
| SMILES | Oc1ccc2c(c1Cl)Oc1c(ccc(O)c1Cl)C21OCc2ccccc21 |
| InChI | InChI=1S/C20H12Cl2O4/c21-16-14(23)7-5-12-18(16)26-19-13(6-8-15(24)17(19)22)20(12)11-4-2-1-3-10(11)9-25-20/h1-8,23-24H,9H2 |
| InChIKey | GPCPZLHYVRVZDD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |