C23H19F4N3O2 — CID 66814034
N-[(2R)-8-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 66814034) has the molecular formula C23H19F4N3O2 and a molecular weight of 445.42 g/mol. Its IUPAC name is N-[(2R)-8-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-[(2R)-8-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66814034 |
| Molecular Formula | C23H19F4N3O2 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[(2R)-8-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2cccc(-c3ccncc3F)c2C1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C23H19F4N3O2/c24-20-12-28-9-8-18(20)17-3-1-2-14-4-6-16(10-19(14)17)30-22(31)15-5-7-21(29-11-15)32-13-23(25,26)27/h1-3,5,7-9,11-12,16H,4,6,10,13H2,(H,30,31)/t16-/m1/s1 |
| InChIKey | PYZWCAPARPDLST-MRXNPFEDSA-N |
| XLogP | 4.51 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |