C34H40N6O4 — CID 66814297
tert-butyl N-[3-[2-amino-4-[bis[(4-methoxyphenyl)methyl]amino]imidazo[4,5-c]quinolin-1-yl]propyl]carbamate (PubChem CID 66814297) has the molecular formula C34H40N6O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is tert-butyl N-[3-[2-amino-4-[bis[(4-methoxyphenyl)methyl]amino]imidazo[4,5-c]quinolin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-amino-4-[bis[(4-methoxyphenyl)methyl]amino]imidazo[4,5-c]quinolin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 66814297 |
| Molecular Formula | C34H40N6O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | tert-butyl N-[3-[2-amino-4-[bis[(4-methoxyphenyl)methyl]amino]imidazo[4,5-c]quinolin-1-yl]propyl]carbamate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc3ccccc3c3c2nc(N)n3CCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H40N6O4/c1-34(2,3)44-33(41)36-19-8-20-40-30-27-9-6-7-10-28(27)37-31(29(30)38-32(40)35)39(21-23-11-15-25(42-4)16-12-23)22-24-13-17-26(43-5)18-14-24/h6-7,9-18H,8,19-22H2,1-5H3,(H2,35,38)(H,36,41) |
| InChIKey | JHJZMXNNRBJTNL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|