C31H33F2N5O5S — CID 66814355
5-[[but-2-ynyl-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoyl]amino]-2,4-difluorobenzamide (PubChem CID 66814355) has the molecular formula C31H33F2N5O5S and a molecular weight of 625.70 g/mol. Its IUPAC name is 5-[[but-2-ynyl-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoyl]amino]-2,4-difluorobenzamide.
| Compound Name | 5-[[but-2-ynyl-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoyl]amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 66814355 |
| Molecular Formula | C31H33F2N5O5S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 5-[[but-2-ynyl-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoyl]amino]-2,4-difluorobenzamide |
| SMILES | CC#CCN(C(=O)Nc1cc(C(N)=O)c(F)cc1F)C1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H33F2N5O5S/c1-3-4-15-38(31(40)35-29-18-26(30(34)39)27(32)19-28(29)33)23-13-16-37(17-14-23)20-21-5-9-24(10-6-21)43-25-11-7-22(8-12-25)36-44(2,41)42/h5-12,18-19,23,36H,13-17,20H2,1-2H3,(H2,34,39)(H,35,40) |
| InChIKey | OOHDMNMJOPIDTL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|