About 1-ethenylcyclohexa-2,4-dien-1-ol
1-ethenylcyclohexa-2,4-dien-1-ol (PubChem CID 66814582) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-ethenylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1-ethenylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 66814582 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1-ethenylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1(O)C=CC=CC1 |
| InChI | InChI=1S/C8H10O/c1-2-8(9)6-4-3-5-7-8/h2-6,9H,1,7H2 |
| InChIKey | DVAXOVZBOHTDAJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 1-ethenylcyclohexa-2,4-dien-1-ol (CID 66814582) is 1-ethenylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 1-ethenylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 1-ethenylcyclohexa-2,4-dien-1-ol is C=CC1(O)C=CC=CC1.
What is the InChIKey of 1-ethenylcyclohexa-2,4-dien-1-ol?
The InChIKey is DVAXOVZBOHTDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-2-8(9)6-4-3-5-7-8/h2-6,9H,1,7H2.
What are the key properties of 1-ethenylcyclohexa-2,4-dien-1-ol?
1-ethenylcyclohexa-2,4-dien-1-ol has a molecular weight of 122.17 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 66814582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).