About (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate
(4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate (PubChem CID 66815252) has the molecular formula C20H29NO6
and a molecular weight of 379.45 g/mol. Its IUPAC name is (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate.
Molecular Properties
| Compound Name | (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate |
| PubChem CID | 66815252 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate |
| SMILES | CCOC(=O)OC1(OC(=O)Cc2c(C)cc(C)cc2C)CCN(OC)CC1 |
| InChI | InChI=1S/C20H29NO6/c1-6-25-19(23)27-20(7-9-21(24-5)10-8-20)26-18(22)13-17-15(3)11-14(2)12-16(17)4/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | AZJCORSWVJSUHP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The IUPAC name of (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate (CID 66815252) is (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate.
What is the SMILES notation for (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The canonical SMILES for (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate is CCOC(=O)OC1(OC(=O)Cc2c(C)cc(C)cc2C)CCN(OC)CC1.
What is the InChIKey of (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The InChIKey is AZJCORSWVJSUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO6/c1-6-25-19(23)27-20(7-9-21(24-5)10-8-20)26-18(22)13-17-15(3)11-14(2)12-16(17)4/h11-12H,6-10,13H2,1-5H3.
What are the key properties of (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
(4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate has a molecular weight of 379.45 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxycarbonyloxy-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate is sourced from PubChem (CID 66815252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).