C28H27IN4O4 — CID 66815282
(5R)-3-[(1S,2S)-1-(6-iodo-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(1-methoxyethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 66815282) has the molecular formula C28H27IN4O4 and a molecular weight of 610.45 g/mol. Its IUPAC name is (5R)-3-[(1S,2S)-1-(6-iodo-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(1-methoxyethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(1S,2S)-1-(6-iodo-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(1-methoxyethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66815282 |
| Molecular Formula | C28H27IN4O4 |
| Molecular Weight | 610.45 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (5R)-3-[(1S,2S)-1-(6-iodo-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(1-methoxyethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | COC(C)Oc1ccc([C@H]2NC(=O)N([C@H](c3nc4ccc(I)cc4[nH]3)[C@@H](C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H27IN4O4/c1-16(18-7-5-4-6-8-18)25(26-30-22-14-11-20(29)15-23(22)31-26)33-27(34)24(32-28(33)35)19-9-12-21(13-10-19)37-17(2)36-3/h4-17,24-25H,1-3H3,(H,30,31)(H,32,35)/t16-,17?,24+,25-/m0/s1 |
| InChIKey | PWOMUXCJKWNFOA-IQHOJVDBSA-N |
| XLogP | 5.68 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|