C18H21N5O2 — CID 66815379
4-(3-ethoxypropoxy)-6-N-phenylpyrido[3,2-d]pyrimidine-2,6-diamine (PubChem CID 66815379) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(3-ethoxypropoxy)-6-N-phenylpyrido[3,2-d]pyrimidine-2,6-diamine.
| Compound Name | 4-(3-ethoxypropoxy)-6-N-phenylpyrido[3,2-d]pyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 66815379 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-(3-ethoxypropoxy)-6-N-phenylpyrido[3,2-d]pyrimidine-2,6-diamine |
| SMILES | CCOCCCOc1nc(N)nc2ccc(Nc3ccccc3)nc12 |
| InChI | InChI=1S/C18H21N5O2/c1-2-24-11-6-12-25-17-16-14(21-18(19)23-17)9-10-15(22-16)20-13-7-4-3-5-8-13/h3-5,7-10H,2,6,11-12H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | HUQQTPCXAJGPFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|