C21H31FN6OSi — CID 66815567
2-[[4-[1-[2-fluoro-1-[(3S)-pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 66815567) has the molecular formula C21H31FN6OSi and a molecular weight of 430.60 g/mol. Its IUPAC name is 2-[[4-[1-[2-fluoro-1-[(3S)-pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[2-fluoro-1-[(3S)-pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66815567 |
| Molecular Formula | C21H31FN6OSi |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-[[4-[1-[2-fluoro-1-[(3S)-pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)[C@H]4CCNC4)c3)ncnc21 |
| InChI | InChI=1S/C21H31FN6OSi/c1-30(2,3)9-8-29-15-27-7-5-18-20(24-14-25-21(18)27)17-12-26-28(13-17)19(10-22)16-4-6-23-11-16/h5,7,12-14,16,19,23H,4,6,8-11,15H2,1-3H3/t16-,19?/m0/s1 |
| InChIKey | DWDOKPPYXKGGGD-UCFFOFKASA-N |
| XLogP | 3.73 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|