C31H43F3N4O5S — CID 66815825
N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-(2-methoxyethyl)acetamide (PubChem CID 66815825) has the molecular formula C31H43F3N4O5S and a molecular weight of 640.77 g/mol. Its IUPAC name is N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 66815825 |
| Molecular Formula | C31H43F3N4O5S |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCN(C(C)=O)c1cc(C)c(C=CS(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CCC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C31H43F3N4O5S/c1-21-19-26(38(23(3)39)16-17-43-4)20-22(2)27(21)10-18-44(41,42)37-14-12-30(13-15-37)29(40)35-28(36-30)25-7-5-24(6-8-25)9-11-31(32,33)34/h10,18-20,24-25H,5-9,11-17H2,1-4H3,(H,35,36,40) |
| InChIKey | HUFONSABPOJJSA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |