C32H45F3N4O6S — CID 66815883
N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 66815883) has the molecular formula C32H45F3N4O6S and a molecular weight of 670.80 g/mol. Its IUPAC name is N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 66815883 |
| Molecular Formula | C32H45F3N4O6S |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | N-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | CC(=O)N(CCOCCO)c1cc(C)c(C=CS(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CCC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C32H45F3N4O6S/c1-22-20-27(39(24(3)41)15-17-45-18-16-40)21-23(2)28(22)9-19-46(43,44)38-13-11-31(12-14-38)30(42)36-29(37-31)26-6-4-25(5-7-26)8-10-32(33,34)35/h9,19-21,25-26,40H,4-8,10-18H2,1-3H3,(H,36,37,42) |
| InChIKey | OCZJRFKDUYEOEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|