C31H41F3N4O5S — CID 66816070
1-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 66816070) has the molecular formula C31H41F3N4O5S and a molecular weight of 638.75 g/mol. Its IUPAC name is 1-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66816070 |
| Molecular Formula | C31H41F3N4O5S |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 1-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(CN2C(=O)CCC2=O)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C31H41F3N4O5S/c1-20-17-23(19-38-26(39)7-8-27(38)40)18-21(2)25(20)10-16-44(42,43)37-14-12-30(13-15-37)29(41)35-28(36-30)24-5-3-22(4-6-24)9-11-31(32,33)34/h17-18,22,24H,3-16,19H2,1-2H3,(H,35,36,41) |
| InChIKey | DRTWQZNOLCRZQK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|