C30H43F3N4O4S — CID 66816100
N-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]-N-methylacetamide (PubChem CID 66816100) has the molecular formula C30H43F3N4O4S and a molecular weight of 612.76 g/mol. Its IUPAC name is N-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]-N-methylacetamide.
| Compound Name | N-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 66816100 |
| Molecular Formula | C30H43F3N4O4S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | N-[[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)Cc1cc(C)c(CCS(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CCC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C30H43F3N4O4S/c1-20-17-24(19-36(4)22(3)38)18-21(2)26(20)10-16-42(40,41)37-14-12-29(13-15-37)28(39)34-27(35-29)25-7-5-23(6-8-25)9-11-30(31,32)33/h17-18,23,25H,5-16,19H2,1-4H3,(H,34,35,39) |
| InChIKey | JIZHHISSTGLDSS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |