C29H38F3N5O5S — CID 66816101
N'-acetyl-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzohydrazide (PubChem CID 66816101) has the molecular formula C29H38F3N5O5S and a molecular weight of 625.71 g/mol. Its IUPAC name is N'-acetyl-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzohydrazide.
| Compound Name | N'-acetyl-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzohydrazide |
|---|---|
| PubChem CID | 66816101 |
| Molecular Formula | C29H38F3N5O5S |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | N'-acetyl-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzohydrazide |
| SMILES | CC(=O)NNC(=O)c1cc(C)c(/C=C/S(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CCC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C29H38F3N5O5S/c1-18-16-23(26(39)36-35-20(3)38)17-19(2)24(18)9-15-43(41,42)37-13-11-28(12-14-37)27(40)33-25(34-28)22-6-4-21(5-7-22)8-10-29(30,31)32/h9,15-17,21-22H,4-8,10-14H2,1-3H3,(H,35,38)(H,36,39)(H,33,34,40)/b15-9+ |
| InChIKey | WYTNOGCHEBAQBW-OQLLNIDSSA-N |
| XLogP | 3.90 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|