C30H41F3N4O5S — CID 66816133
8-[2-[2,6-dimethyl-4-(1,2-oxazolidine-2-carbonyl)phenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816133) has the molecular formula C30H41F3N4O5S and a molecular weight of 626.74 g/mol. Its IUPAC name is 8-[2-[2,6-dimethyl-4-(1,2-oxazolidine-2-carbonyl)phenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[2,6-dimethyl-4-(1,2-oxazolidine-2-carbonyl)phenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816133 |
| Molecular Formula | C30H41F3N4O5S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 8-[2-[2,6-dimethyl-4-(1,2-oxazolidine-2-carbonyl)phenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(C(=O)N2CCCO2)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C30H41F3N4O5S/c1-20-18-24(27(38)37-13-3-16-42-37)19-21(2)25(20)9-17-43(40,41)36-14-11-29(12-15-36)28(39)34-26(35-29)23-6-4-22(5-7-23)8-10-30(31,32)33/h18-19,22-23H,3-17H2,1-2H3,(H,34,35,39) |
| InChIKey | ALCCKYGBLNDTEL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |