C31H41F3N4O4S — CID 66816150
8-[2-[2,6-dimethyl-4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816150) has the molecular formula C31H41F3N4O4S and a molecular weight of 622.75 g/mol. Its IUPAC name is 8-[2-[2,6-dimethyl-4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[2,6-dimethyl-4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816150 |
| Molecular Formula | C31H41F3N4O4S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 8-[2-[2,6-dimethyl-4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(CN2CCCC2=O)cc(C)c1C=CS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C31H41F3N4O4S/c1-21-18-24(20-37-14-3-4-27(37)39)19-22(2)26(21)10-17-43(41,42)38-15-12-30(13-16-38)29(40)35-28(36-30)25-7-5-23(6-8-25)9-11-31(32,33)34/h10,17-19,23,25H,3-9,11-16,20H2,1-2H3,(H,35,36,40) |
| InChIKey | GIRGAYSMHKHTQP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |