C28H39F3N4O3S — CID 66816261
8-[(E)-2-[2,6-dimethyl-4-(methylaminomethyl)phenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816261) has the molecular formula C28H39F3N4O3S and a molecular weight of 568.71 g/mol. Its IUPAC name is 8-[(E)-2-[2,6-dimethyl-4-(methylaminomethyl)phenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[(E)-2-[2,6-dimethyl-4-(methylaminomethyl)phenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816261 |
| Molecular Formula | C28H39F3N4O3S |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 8-[(E)-2-[2,6-dimethyl-4-(methylaminomethyl)phenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CNCc1cc(C)c(/C=C/S(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CCC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C28H39F3N4O3S/c1-19-16-22(18-32-3)17-20(2)24(19)9-15-39(37,38)35-13-11-27(12-14-35)26(36)33-25(34-27)23-6-4-21(5-7-23)8-10-28(29,30)31/h9,15-17,21,23,32H,4-8,10-14,18H2,1-3H3,(H,33,34,36)/b15-9+ |
| InChIKey | HIMHDOGLCYYYTK-OQLLNIDSSA-N |
| XLogP | 4.84 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |