About 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol
3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol (PubChem CID 66816322) has the molecular formula C11H15BrO3
and a molecular weight of 275.14 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol |
| PubChem CID | 66816322 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol |
| SMILES | Cc1cc(OCC(O)CO)cc(C)c1Br |
| InChI | InChI=1S/C11H15BrO3/c1-7-3-10(4-8(2)11(7)12)15-6-9(14)5-13/h3-4,9,13-14H,5-6H2,1-2H3 |
| InChIKey | PNNSNAUGFXVMNM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol?
The IUPAC name of 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol (CID 66816322) is 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol?
The canonical SMILES for 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol is Cc1cc(OCC(O)CO)cc(C)c1Br.
What is the InChIKey of 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol?
The InChIKey is PNNSNAUGFXVMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO3/c1-7-3-10(4-8(2)11(7)12)15-6-9(14)5-13/h3-4,9,13-14H,5-6H2,1-2H3.
What are the key properties of 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol?
3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol has a molecular weight of 275.14 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylphenoxy)propane-1,2-diol is sourced from PubChem (CID 66816322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).