C29H41F3N4O4S — CID 66816348
N,N,3,5-tetramethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzamide (PubChem CID 66816348) has the molecular formula C29H41F3N4O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is N,N,3,5-tetramethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzamide.
| Compound Name | N,N,3,5-tetramethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzamide |
|---|---|
| PubChem CID | 66816348 |
| Molecular Formula | C29H41F3N4O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | N,N,3,5-tetramethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzamide |
| SMILES | Cc1cc(C(=O)N(C)C)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C29H41F3N4O4S/c1-19-17-23(26(37)35(3)4)18-20(2)24(19)10-16-41(39,40)36-14-12-28(13-15-36)27(38)33-25(34-28)22-7-5-21(6-8-22)9-11-29(30,31)32/h17-18,21-22H,5-16H2,1-4H3,(H,33,34,38) |
| InChIKey | LKRYUUULTGKFQS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |