C30H37F3N4O5S — CID 66816492
8-[2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]indol-4-yl]ethenylsulfonyl]-2-[4-(trifluoromethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816492) has the molecular formula C30H37F3N4O5S and a molecular weight of 622.71 g/mol. Its IUPAC name is 8-[2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]indol-4-yl]ethenylsulfonyl]-2-[4-(trifluoromethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]indol-4-yl]ethenylsulfonyl]-2-[4-(trifluoromethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816492 |
| Molecular Formula | C30H37F3N4O5S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 8-[2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]indol-4-yl]ethenylsulfonyl]-2-[4-(trifluoromethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1(C)OC[C@H](Cn2ccc3c(C=CS(=O)(=O)N4CCC5(CC4)N=C(C4CCC(C(F)(F)F)CC4)NC5=O)cccc32)O1 |
| InChI | InChI=1S/C30H37F3N4O5S/c1-28(2)41-19-23(42-28)18-36-14-10-24-20(4-3-5-25(24)36)11-17-43(39,40)37-15-12-29(13-16-37)27(38)34-26(35-29)21-6-8-22(9-7-21)30(31,32)33/h3-5,10-11,14,17,21-23H,6-9,12-13,15-16,18-19H2,1-2H3,(H,34,35,38)/t21?,22?,23-/m0/s1 |
| InChIKey | SRZUKYAOGHWFGS-VNXZQDSDSA-N |
| XLogP | 4.82 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |