C31H34F3N5O7S — CID 66816691
3-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 66816691) has the molecular formula C31H34F3N5O7S and a molecular weight of 677.70 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66816691 |
| Molecular Formula | C31H34F3N5O7S |
| Molecular Weight | 677.70 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | 3-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc(N2C(=O)N(CCO)C(C)(C)C2=O)cc(C)c1/C=C/S(=O)(=O)N1CCC2(CC1)N=C(c1cccc(OC(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C31H34F3N5O7S/c1-19-16-22(39-27(42)29(3,4)38(13-14-40)28(39)43)17-20(2)24(19)8-15-47(44,45)37-11-9-30(10-12-37)26(41)35-25(36-30)21-6-5-7-23(18-21)46-31(32,33)34/h5-8,15-18,40H,9-14H2,1-4H3,(H,35,36,41)/b15-8+ |
| InChIKey | LZJMYAATYSSAEQ-OVCLIPMQSA-N |
| XLogP | 3.45 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|