C26H34N4O3S — CID 66816819
2-cyclohexyl-8-[(E)-5-(1H-indol-4-yl)pent-4-enyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816819) has the molecular formula C26H34N4O3S and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-cyclohexyl-8-[(E)-5-(1H-indol-4-yl)pent-4-enyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-cyclohexyl-8-[(E)-5-(1H-indol-4-yl)pent-4-enyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816819 |
| Molecular Formula | C26H34N4O3S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-cyclohexyl-8-[(E)-5-(1H-indol-4-yl)pent-4-enyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | O=C1NC(C2CCCCC2)=NC12CCN(S(=O)(=O)CCC/C=C/c1cccc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C26H34N4O3S/c31-25-26(29-24(28-25)21-9-3-1-4-10-21)14-17-30(18-15-26)34(32,33)19-6-2-5-8-20-11-7-12-23-22(20)13-16-27-23/h5,7-8,11-13,16,21,27H,1-4,6,9-10,14-15,17-19H2,(H,28,29,31)/b8-5+ |
| InChIKey | NJPQZBCECUSBHB-VMPITWQZSA-N |
| XLogP | 4.23 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|