C33H45F3N4O5S — CID 66817144
8-[2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66817144) has the molecular formula C33H45F3N4O5S and a molecular weight of 666.81 g/mol. Its IUPAC name is 8-[2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66817144 |
| Molecular Formula | C33H45F3N4O5S |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | 8-[2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(C(=O)N2CCC(C)(O)CC2)cc(C)c1C=CS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C33H45F3N4O5S/c1-22-20-26(29(41)39-15-11-31(3,43)12-16-39)21-23(2)27(22)9-19-46(44,45)40-17-13-32(14-18-40)30(42)37-28(38-32)25-6-4-24(5-7-25)8-10-33(34,35)36/h9,19-21,24-25,43H,4-8,10-18H2,1-3H3,(H,37,38,42) |
| InChIKey | CXQICQXEIOUQTG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |