C29H41N5O5S — CID 66817221
1-[4-[2-[[2-(4-ethylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 66817221) has the molecular formula C29H41N5O5S and a molecular weight of 571.74 g/mol. Its IUPAC name is 1-[4-[2-[[2-(4-ethylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[4-[2-[[2-(4-ethylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66817221 |
| Molecular Formula | C29H41N5O5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 1-[4-[2-[[2-(4-ethylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCC1CCC(C2=NC3(CCN(S(=O)(=O)CCc4ccc(N5C(=O)NC(=O)C5(C)C)cc4C)CC3)C(=O)N2)CC1 |
| InChI | InChI=1S/C29H41N5O5S/c1-5-20-6-8-22(9-7-20)24-30-26(36)29(32-24)13-15-33(16-14-29)40(38,39)17-12-21-10-11-23(18-19(21)2)34-27(37)31-25(35)28(34,3)4/h10-11,18,20,22H,5-9,12-17H2,1-4H3,(H,30,32,36)(H,31,35,37) |
| InChIKey | VUEAIYMRKDTCQF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|