About (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride
(3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride (PubChem CID 66817259) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride |
| PubChem CID | 66817259 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride |
| SMILES | C=CCO[C@H]1CNC[C@@H]1O.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-2-3-10-7-5-8-4-6(7)9;/h2,6-9H,1,3-5H2;1H/t6-,7-;/m0./s1 |
| InChIKey | BJPFVIVTRACXGZ-LEUCUCNGSA-N |
| XLogP | -0.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride?
The IUPAC name of (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride (CID 66817259) is (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride is C=CCO[C@H]1CNC[C@@H]1O.Cl.
What is the InChIKey of (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride?
The InChIKey is BJPFVIVTRACXGZ-LEUCUCNGSA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c1-2-3-10-7-5-8-4-6(7)9;/h2,6-9H,1,3-5H2;1H/t6-,7-;/m0./s1.
What are the key properties of (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride?
(3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of -0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-prop-2-enoxypyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 66817259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).