C32H49NO6Si — CID 66817451
tert-butyl N-[2-[[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethyl]-N-methylcarbamate (PubChem CID 66817451) has the molecular formula C32H49NO6Si and a molecular weight of 571.83 g/mol. Its IUPAC name is tert-butyl N-[2-[[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 66817451 |
| Molecular Formula | C32H49NO6Si |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | tert-butyl N-[2-[[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOC[C@H]1OC(C)(C)O[C@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H49NO6Si/c1-30(2,3)39-29(34)33(9)21-23-35-24-28-27(37-32(7,8)38-28)20-22-36-40(31(4,5)6,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-19,27-28H,20-24H2,1-9H3/t27-,28+/m0/s1 |
| InChIKey | JACCOHPXXXJEQQ-WUFINQPMSA-N |
| XLogP | 5.36 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|