About tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate
tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate (PubChem CID 66817503) has the molecular formula C18H29N3O3
and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
| PubChem CID | 66817503 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)N=C(C1CCCCC1)NC2=O |
| InChI | InChI=1S/C18H29N3O3/c1-17(2,3)24-16(23)21-11-9-18(10-12-21)15(22)19-14(20-18)13-7-5-4-6-8-13/h13H,4-12H2,1-3H3,(H,19,20,22) |
| InChIKey | PCDXMXPFTRUITN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate?
The IUPAC name of tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate (CID 66817503) is tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate.
What is the SMILES notation for tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate?
The canonical SMILES for tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate is CC(C)(C)OC(=O)N1CCC2(CC1)N=C(C1CCCCC1)NC2=O.
What is the InChIKey of tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate?
The InChIKey is PCDXMXPFTRUITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3/c1-17(2,3)24-16(23)21-11-9-18(10-12-21)15(22)19-14(20-18)13-7-5-4-6-8-13/h13H,4-12H2,1-3H3,(H,19,20,22).
What are the key properties of tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate?
tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate has a molecular weight of 335.45 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyclohexyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate is sourced from PubChem (CID 66817503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).